C26H28N3O2+ — CID 8858744
(2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide (PubChem CID 8858744) has the molecular formula C26H28N3O2+ and a molecular weight of 414.53 g/mol. Its IUPAC name is (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide.
| Compound Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 8858744 |
| Molecular Formula | C26H28N3O2+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | (2R)-2-(4-benzoylpyridin-1-ium-1-yl)-N-(4-piperidin-1-ylphenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(N2CCCCC2)cc1)[n+]1ccc(C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H27N3O2/c1-20(28-18-14-22(15-19-28)25(30)21-8-4-2-5-9-21)26(31)27-23-10-12-24(13-11-23)29-16-6-3-7-17-29/h2,4-5,8-15,18-20H,3,6-7,16-17H2,1H3/p+1/t20-/m1/s1 |
| InChIKey | LXHHGMXJYJSGAA-HXUWFJFHSA-O |
| XLogP | 4.40 |
| TPSA | 53.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|