C28H33ClN2O3 — CID 88588545
(E)-N-[(2R)-1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-oxo-4-phenylbut-2-enamide (PubChem CID 88588545) has the molecular formula C28H33ClN2O3 and a molecular weight of 481.04 g/mol. Its IUPAC name is (E)-N-[(2R)-1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-oxo-4-phenylbut-2-enamide.
| Compound Name | (E)-N-[(2R)-1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-oxo-4-phenylbut-2-enamide |
|---|---|
| PubChem CID | 88588545 |
| Molecular Formula | C28H33ClN2O3 |
| Molecular Weight | 481.04 g/mol |
| Exact Mass | 480.22 |
| IUPAC Name | (E)-N-[(2R)-1-[4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-4-oxo-4-phenylbut-2-enamide |
| SMILES | CC(C)[C@@H](NC(=O)/C=C/C(=O)c1ccccc1)C(=O)N1CCC(c2ccc(Cl)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C28H33ClN2O3/c1-19(2)26(30-25(33)15-14-24(32)21-8-6-5-7-9-21)27(34)31-17-16-23(28(3,4)18-31)20-10-12-22(29)13-11-20/h5-15,19,23,26H,16-18H2,1-4H3,(H,30,33)/b15-14+/t23?,26-/m1/s1 |
| InChIKey | BGSSVNCUQRJESH-VEPDHZJOSA-N |
| XLogP | 5.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|