C24H32Cl3N3O2 — CID 58457617
5,6-dichloro-N-[(2R)-1-[(4R)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2,3,4,5-tetrahydropyridine-3-carboxamide (PubChem CID 58457617) has the molecular formula C24H32Cl3N3O2 and a molecular weight of 500.90 g/mol. Its IUPAC name is 5,6-dichloro-N-[(2R)-1-[(4R)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2,3,4,5-tetrahydropyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[(2R)-1-[(4R)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2,3,4,5-tetrahydropyridine-3-carboxamide |
|---|---|
| PubChem CID | 58457617 |
| Molecular Formula | C24H32Cl3N3O2 |
| Molecular Weight | 500.90 g/mol |
| Exact Mass | 499.16 |
| IUPAC Name | 5,6-dichloro-N-[(2R)-1-[(4R)-4-(4-chlorophenyl)-3,3-dimethylpiperidin-1-yl]-3-methyl-1-oxobutan-2-yl]-2,3,4,5-tetrahydropyridine-3-carboxamide |
| SMILES | CC(C)[C@@H](NC(=O)C1CN=C(Cl)C(Cl)C1)C(=O)N1CC[C@H](c2ccc(Cl)cc2)C(C)(C)C1 |
| InChI | InChI=1S/C24H32Cl3N3O2/c1-14(2)20(29-22(31)16-11-19(26)21(27)28-12-16)23(32)30-10-9-18(24(3,4)13-30)15-5-7-17(25)8-6-15/h5-8,14,16,18-20H,9-13H2,1-4H3,(H,29,31)/t16?,18-,19?,20-/m1/s1 |
| InChIKey | ITEHCDXURUMMQG-RDVQEIBISA-N |
| XLogP | 5.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.90 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|