C30H43NO9 — CID 88592345
[(3E,5Z,7S,8S,9E,11S,12R,13S,15R,17Z,20E)-21-formyl-12-hydroxy-7,13,18-trimethoxy-3,9,11,15,17-pentamethyl-2,19-dioxo-1-azacyclohenicosa-3,5,9,17,20-pentaen-8-yl] formate (PubChem CID 88592345) has the molecular formula C30H43NO9 and a molecular weight of 561.67 g/mol. Its IUPAC name is [(3E,5Z,7S,8S,9E,11S,12R,13S,15R,17Z,20E)-21-formyl-12-hydroxy-7,13,18-trimethoxy-3,9,11,15,17-pentamethyl-2,19-dioxo-1-azacyclohenicosa-3,5,9,17,20-pentaen-8-yl] formate.
| Compound Name | [(3E,5Z,7S,8S,9E,11S,12R,13S,15R,17Z,20E)-21-formyl-12-hydroxy-7,13,18-trimethoxy-3,9,11,15,17-pentamethyl-2,19-dioxo-1-azacyclohenicosa-3,5,9,17,20-pentaen-8-yl] formate |
|---|---|
| PubChem CID | 88592345 |
| Molecular Formula | C30H43NO9 |
| Molecular Weight | 561.67 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [(3E,5Z,7S,8S,9E,11S,12R,13S,15R,17Z,20E)-21-formyl-12-hydroxy-7,13,18-trimethoxy-3,9,11,15,17-pentamethyl-2,19-dioxo-1-azacyclohenicosa-3,5,9,17,20-pentaen-8-yl] formate |
| SMILES | CO/C1=C(/C)C[C@@H](C)C[C@H](OC)[C@H](O)[C@@H](C)/C=C(\C)[C@H](OC=O)[C@@H](OC)/C=C\C=C(/C)C(=O)N/C(C=O)=C/C1=O |
| InChI | InChI=1S/C30H43NO9/c1-18-12-21(4)28(39-8)24(34)15-23(16-32)31-30(36)19(2)10-9-11-25(37-6)29(40-17-33)22(5)14-20(3)27(35)26(13-18)38-7/h9-11,14-18,20,25-27,29,35H,12-13H2,1-8H3,(H,31,36)/b11-9-,19-10+,22-14+,23-15+,28-21-/t18-,20+,25+,26+,27-,29+/m1/s1 |
| InChIKey | NDNDYUXKXQNBFI-MBGIKOPRSA-N |
| XLogP | 3.12 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.67 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|