C28H37NO7 — CID 89188425
[(4E,6Z,8S,9R,10E,12S,13R,14S,16R)-13-hydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] formate (PubChem CID 89188425) has the molecular formula C28H37NO7 and a molecular weight of 499.60 g/mol. Its IUPAC name is [(4E,6Z,8S,9R,10E,12S,13R,14S,16R)-13-hydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] formate.
| Compound Name | [(4E,6Z,8S,9R,10E,12S,13R,14S,16R)-13-hydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] formate |
|---|---|
| PubChem CID | 89188425 |
| Molecular Formula | C28H37NO7 |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.26 |
| IUPAC Name | [(4E,6Z,8S,9R,10E,12S,13R,14S,16R)-13-hydroxy-14-methoxy-4,8,10,12,16-pentamethyl-3,20,22-trioxo-2-azabicyclo[16.3.1]docosa-1(21),4,6,10,18-pentaen-9-yl] formate |
| SMILES | CO[C@H]1C[C@H](C)CC2=CC(=O)C=C(NC(=O)/C(C)=C/C=C\[C@H](C)[C@@H](OC=O)/C(C)=C/[C@H](C)[C@H]1O)C2=O |
| InChI | InChI=1S/C28H37NO7/c1-16-10-21-13-22(31)14-23(26(21)33)29-28(34)18(3)9-7-8-17(2)27(36-15-30)20(5)12-19(4)25(32)24(11-16)35-6/h7-9,12-17,19,24-25,27,32H,10-11H2,1-6H3,(H,29,34)/b8-7-,18-9+,20-12+/t16-,17+,19+,24+,25-,27-/m1/s1 |
| InChIKey | LFKJEAZHPXYZTL-GLKCCXEHSA-N |
| XLogP | 3.13 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|