C60H76F2N4O10 — CID 88593088
bis[2-[(4-fluorophenyl)methyl-[1-[2-[(4S)-4-methyl-1,3-dioxolan-2-yl]ethyl]piperidin-4-yl]amino]-2-oxo-1-(4-propan-2-ylphenyl)ethyl] oxalate (PubChem CID 88593088) has the molecular formula C60H76F2N4O10 and a molecular weight of 1051.28 g/mol. Its IUPAC name is bis[2-[(4-fluorophenyl)methyl-[1-[2-[(4S)-4-methyl-1,3-dioxolan-2-yl]ethyl]piperidin-4-yl]amino]-2-oxo-1-(4-propan-2-ylphenyl)ethyl] oxalate.
| Compound Name | bis[2-[(4-fluorophenyl)methyl-[1-[2-[(4S)-4-methyl-1,3-dioxolan-2-yl]ethyl]piperidin-4-yl]amino]-2-oxo-1-(4-propan-2-ylphenyl)ethyl] oxalate |
|---|---|
| PubChem CID | 88593088 |
| Molecular Formula | C60H76F2N4O10 |
| Molecular Weight | 1051.28 g/mol |
| Exact Mass | 1050.55 |
| IUPAC Name | bis[2-[(4-fluorophenyl)methyl-[1-[2-[(4S)-4-methyl-1,3-dioxolan-2-yl]ethyl]piperidin-4-yl]amino]-2-oxo-1-(4-propan-2-ylphenyl)ethyl] oxalate |
| SMILES | CC(C)c1ccc(C(OC(=O)C(=O)OC(C(=O)N(Cc2ccc(F)cc2)C2CCN(CCC3OC[C@H](C)O3)CC2)c2ccc(C(C)C)cc2)C(=O)N(Cc2ccc(F)cc2)C2CCN(CCC3OC[C@H](C)O3)CC2)cc1 |
| InChI | InChI=1S/C60H76F2N4O10/c1-39(2)45-11-15-47(16-12-45)55(57(67)65(35-43-7-19-49(61)20-8-43)51-23-29-63(30-24-51)33-27-53-71-37-41(5)73-53)75-59(69)60(70)76-56(48-17-13-46(14-18-48)40(3)4)58(68)66(36-44-9-21-50(62)22-10-44)52-25-31-64(32-26-52)34-28-54-72-38-42(6)74-54/h7-22,39-42,51-56H,23-38H2,1-6H3/t41-,42-,53?,54?,55?,56?/m0/s1 |
| InChIKey | HCYLMONTLINQLZ-TYWNJZEKSA-N |
| XLogP | 9.37 |
| TPSA | 136.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1051.28 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|