C66H88F2N4O12 — CID 88593191
bis[2-[[1-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-[(4-fluorophenyl)methyl]amino]-1-[4-(2-methylpropoxy)phenyl]-2-oxoethyl] oxalate (PubChem CID 88593191) has the molecular formula C66H88F2N4O12 and a molecular weight of 1167.44 g/mol. Its IUPAC name is bis[2-[[1-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-[(4-fluorophenyl)methyl]amino]-1-[4-(2-methylpropoxy)phenyl]-2-oxoethyl] oxalate.
| Compound Name | bis[2-[[1-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-[(4-fluorophenyl)methyl]amino]-1-[4-(2-methylpropoxy)phenyl]-2-oxoethyl] oxalate |
|---|---|
| PubChem CID | 88593191 |
| Molecular Formula | C66H88F2N4O12 |
| Molecular Weight | 1167.44 g/mol |
| Exact Mass | 1166.64 |
| IUPAC Name | bis[2-[[1-[2-(5,5-dimethyl-1,3-dioxan-2-yl)ethyl]piperidin-4-yl]-[(4-fluorophenyl)methyl]amino]-1-[4-(2-methylpropoxy)phenyl]-2-oxoethyl] oxalate |
| SMILES | CC(C)COc1ccc(C(OC(=O)C(=O)OC(C(=O)N(Cc2ccc(F)cc2)C2CCN(CCC3OCC(C)(C)CO3)CC2)c2ccc(OCC(C)C)cc2)C(=O)N(Cc2ccc(F)cc2)C2CCN(CCC3OCC(C)(C)CO3)CC2)cc1 |
| InChI | InChI=1S/C66H88F2N4O12/c1-45(2)39-77-55-21-13-49(14-22-55)59(61(73)71(37-47-9-17-51(67)18-10-47)53-25-31-69(32-26-53)35-29-57-79-41-65(5,6)42-80-57)83-63(75)64(76)84-60(50-15-23-56(24-16-50)78-40-46(3)4)62(74)72(38-48-11-19-52(68)20-12-48)54-27-33-70(34-28-54)36-30-58-81-43-66(7,8)44-82-58/h9-24,45-46,53-54,57-60H,25-44H2,1-8H3 |
| InChIKey | KRQRGLJFKHSWIT-UHFFFAOYSA-N |
| XLogP | 10.47 |
| TPSA | 155.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1167.44 |
| LogP ≤ 5 | 10.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|