C51H43N5 — CID 88594122
N-(4-carbazol-9-ylphenyl)-4-[5-cyclohexa-2,4-dien-1-yl-4-[(2E,4Z)-4-phenylhepta-2,4-dien-3-yl]-1,2,4-triazol-3-yl]-N-phenylaniline (PubChem CID 88594122) has the molecular formula C51H43N5 and a molecular weight of 725.94 g/mol. Its IUPAC name is N-(4-carbazol-9-ylphenyl)-4-[5-cyclohexa-2,4-dien-1-yl-4-[(2E,4Z)-4-phenylhepta-2,4-dien-3-yl]-1,2,4-triazol-3-yl]-N-phenylaniline.
| Compound Name | N-(4-carbazol-9-ylphenyl)-4-[5-cyclohexa-2,4-dien-1-yl-4-[(2E,4Z)-4-phenylhepta-2,4-dien-3-yl]-1,2,4-triazol-3-yl]-N-phenylaniline |
|---|---|
| PubChem CID | 88594122 |
| Molecular Formula | C51H43N5 |
| Molecular Weight | 725.94 g/mol |
| Exact Mass | 725.35 |
| IUPAC Name | N-(4-carbazol-9-ylphenyl)-4-[5-cyclohexa-2,4-dien-1-yl-4-[(2E,4Z)-4-phenylhepta-2,4-dien-3-yl]-1,2,4-triazol-3-yl]-N-phenylaniline |
| SMILES | C/C=C(C(=C/CC)\c1ccccc1)/n1c(-c2ccc(N(c3ccccc3)c3ccc(-n4c5ccccc5c5ccccc54)cc3)cc2)nnc1C1C=CC=CC1 |
| InChI | InChI=1S/C51H43N5/c1-3-18-44(37-19-8-5-9-20-37)47(4-2)56-50(38-21-10-6-11-22-38)52-53-51(56)39-29-31-41(32-30-39)54(40-23-12-7-13-24-40)42-33-35-43(36-34-42)55-48-27-16-14-25-45(48)46-26-15-17-28-49(46)55/h4-21,23-36,38H,3,22H2,1-2H3/b44-18-,47-4+ |
| InChIKey | MIVJNVBRUTUCIA-ZUNVMMDRSA-N |
| XLogP | 13.47 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.94 |
| LogP ≤ 5 | 13.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|