C20H17N3 — CID 149086143
3-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2,4-triazole (PubChem CID 149086143) has the molecular formula C20H17N3 and a molecular weight of 299.38 g/mol. Its IUPAC name is 3-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 149086143 |
| Molecular Formula | C20H17N3 |
| Molecular Weight | 299.38 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 3-cyclohexa-2,4-dien-1-yl-4,5-diphenyl-1,2,4-triazole |
| SMILES | C1=CCC(c2nnc(-c3ccccc3)n2-c2ccccc2)C=C1 |
| InChI | InChI=1S/C20H17N3/c1-4-10-16(11-5-1)19-21-22-20(17-12-6-2-7-13-17)23(19)18-14-8-3-9-15-18/h1-12,14-15,17H,13H2 |
| InChIKey | QRHCMMOFRLRFNY-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.38 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |