C20H21N5O9S2 — CID 88600192
(6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2,2-bis(methoxycarbonyl)cyclopropyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (PubChem CID 88600192) has the molecular formula C20H21N5O9S2 and a molecular weight of 539.55 g/mol. Its IUPAC name is (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2,2-bis(methoxycarbonyl)cyclopropyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid.
| Compound Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2,2-bis(methoxycarbonyl)cyclopropyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
|---|---|
| PubChem CID | 88600192 |
| Molecular Formula | C20H21N5O9S2 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | (6R,7R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-3-[2,2-bis(methoxycarbonyl)cyclopropyl]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| SMILES | CO/N=C(\C(=O)N[C@@H]1C(=O)N2C(C(=O)O)=C(C3CC3(C(=O)OC)C(=O)OC)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C20H21N5O9S2/c1-32-17(30)20(18(31)33-2)4-8(20)7-5-35-15-11(14(27)25(15)12(7)16(28)29)23-13(26)10(24-34-3)9-6-36-19(21)22-9/h6,8,11,15H,4-5H2,1-3H3,(H2,21,22)(H,23,26)(H,28,29)/b24-10-/t8?,11-,15-/m1/s1 |
| InChIKey | HSLDKSVUWWIMMS-SUQKCFEUSA-N |
| XLogP | -0.83 |
| TPSA | 199.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|