C21H20N2O5 — CID 88602568
[1-(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)oxy-2,3-dihydro-1H-inden-2-yl] 2-methoxyacetate (PubChem CID 88602568) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is [1-(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)oxy-2,3-dihydro-1H-inden-2-yl] 2-methoxyacetate.
| Compound Name | [1-(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)oxy-2,3-dihydro-1H-inden-2-yl] 2-methoxyacetate |
|---|---|
| PubChem CID | 88602568 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | [1-(3-formyl-2-methylimidazo[1,2-a]pyridin-8-yl)oxy-2,3-dihydro-1H-inden-2-yl] 2-methoxyacetate |
| SMILES | COCC(=O)OC1Cc2ccccc2C1Oc1cccn2c(C=O)c(C)nc12 |
| InChI | InChI=1S/C21H20N2O5/c1-13-16(11-24)23-9-5-8-17(21(23)22-13)28-20-15-7-4-3-6-14(15)10-18(20)27-19(25)12-26-2/h3-9,11,18,20H,10,12H2,1-2H3 |
| InChIKey | YDAVTOGBQKEWOY-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|