C10H10N2O — CID 2758567
2,8-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde (PubChem CID 2758567) has the molecular formula C10H10N2O and a molecular weight of 174.20 g/mol. Its IUPAC name is 2,8-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde.
| Compound Name | 2,8-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 2758567 |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.08 |
| IUPAC Name | 2,8-dimethylimidazo[1,2-a]pyridine-3-carbaldehyde |
| SMILES | Cc1nc2c(C)cccn2c1C=O |
| InChI | InChI=1S/C10H10N2O/c1-7-4-3-5-12-9(6-13)8(2)11-10(7)12/h3-6H,1-2H3 |
| InChIKey | NAJSJTOWNZKNLS-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|