C24H34N2O6 — CID 88603555
(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide (PubChem CID 88603555) has the molecular formula C24H34N2O6 and a molecular weight of 446.54 g/mol. Its IUPAC name is (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide.
| Compound Name | (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 88603555 |
| Molecular Formula | C24H34N2O6 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | (2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide |
| SMILES | C/C=C/C/C=C/CCC(=O)C1OC1C(N)=O.C/C=C/C/C=C/CCC(=O)[C@H]1O[C@H]1C(N)=O |
| InChI | InChI=1S/2C12H17NO3/c2*1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15/h2*2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15)/b2*3-2+,6-5+/t10-,11-;/m1./s1 |
| InChIKey | YYYNGKNFDJAHGA-SKQAXLADSA-N |
| XLogP | 2.22 |
| TPSA | 145.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|