C46H83NO7 — CID 6475203
hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid (PubChem CID 6475203) has the molecular formula C46H83NO7 and a molecular weight of 762.17 g/mol. Its IUPAC name is hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid.
| Compound Name | hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid |
|---|---|
| PubChem CID | 6475203 |
| Molecular Formula | C46H83NO7 |
| Molecular Weight | 762.17 g/mol |
| Exact Mass | 761.62 |
| IUPAC Name | hexadecanoic acid;(2R,3S)-3-[(4E,7E)-nona-4,7-dienoyl]oxirane-2-carboxamide;(E)-octadec-9-enoic acid |
| SMILES | C/C=C/C/C=C/CCC(=O)[C@H]1O[C@H]1C(N)=O.CCCCCCCC/C=C/CCCCCCCC(=O)O.CCCCCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C18H34O2.C16H32O2.C12H17NO3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18;1-2-3-4-5-6-7-8-9(14)10-11(16-10)12(13)15/h9-10H,2-8,11-17H2,1H3,(H,19,20);2-15H2,1H3,(H,17,18);2-3,5-6,10-11H,4,7-8H2,1H3,(H2,13,15)/b10-9+;;3-2+,6-5+/t;;10-,11-/m..1/s1 |
| InChIKey | FOTXIAXKENEHIM-LGTIZHIASA-N |
| XLogP | 12.77 |
| TPSA | 147.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.17 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|