ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate

C6H12N2O4 — CID 88603843

IUPACethyl 2,4-diamino-2-hydroxy-3-oxobutanoate
SMILESCCOC(=O)C(N)(O)C(=O)CN
InChIInChI=1S/C6H12N2O4/c1-2-12-5(10)6(8,11)4(9)3-7/h11H,2-3,7-8H2,1H3
InChIKeyTUNIAFFYYSBTBX-UHFFFAOYSA-N
MW176.17 g/mol
LogP-2.28
Rot. Bonds4

About ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate

ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate (PubChem CID 88603843) has the molecular formula C6H12N2O4 and a molecular weight of 176.17 g/mol. Its IUPAC name is ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate.

Molecular Properties

Compound Nameethyl 2,4-diamino-2-hydroxy-3-oxobutanoate
PubChem CID88603843
Molecular FormulaC6H12N2O4
Molecular Weight176.17 g/mol
Exact Mass176.08
IUPAC Nameethyl 2,4-diamino-2-hydroxy-3-oxobutanoate
SMILESCCOC(=O)C(N)(O)C(=O)CN
InChIInChI=1S/C6H12N2O4/c1-2-12-5(10)6(8,11)4(9)3-7/h11H,2-3,7-8H2,1H3
InChIKeyTUNIAFFYYSBTBX-UHFFFAOYSA-N
XLogP-2.28
TPSA115.64 Ų
H-Bond Donors3
H-Bond Acceptors6
Rotatable Bonds4
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.17
LogP ≤ 5-2.28
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate?
The IUPAC name of ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate (CID 88603843) is ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate.
What is the SMILES notation for ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate?
The canonical SMILES for ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate is CCOC(=O)C(N)(O)C(=O)CN.
What is the InChIKey of ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate?
The InChIKey is TUNIAFFYYSBTBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O4/c1-2-12-5(10)6(8,11)4(9)3-7/h11H,2-3,7-8H2,1H3.
What are the key properties of ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate?
ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate has a molecular weight of 176.17 g/mol, XLogP of -2.28, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-diamino-2-hydroxy-3-oxobutanoate is sourced from PubChem (CID 88603843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).