About 3-tert-butylperoxy-2,4-dichlorobenzoic acid
3-tert-butylperoxy-2,4-dichlorobenzoic acid (PubChem CID 88604863) has the molecular formula C11H12Cl2O4
and a molecular weight of 279.12 g/mol. Its IUPAC name is 3-tert-butylperoxy-2,4-dichlorobenzoic acid.
Molecular Properties
| Compound Name | 3-tert-butylperoxy-2,4-dichlorobenzoic acid |
| PubChem CID | 88604863 |
| Molecular Formula | C11H12Cl2O4 |
| Molecular Weight | 279.12 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 3-tert-butylperoxy-2,4-dichlorobenzoic acid |
| SMILES | CC(C)(C)OOc1c(Cl)ccc(C(=O)O)c1Cl |
| InChI | InChI=1S/C11H12Cl2O4/c1-11(2,3)17-16-9-7(12)5-4-6(8(9)13)10(14)15/h4-5H,1-3H3,(H,14,15) |
| InChIKey | BTYVJDJBRSJFHJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.12 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butylperoxy-2,4-dichlorobenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butylperoxy-2,4-dichlorobenzoic acid?
The IUPAC name of 3-tert-butylperoxy-2,4-dichlorobenzoic acid (CID 88604863) is 3-tert-butylperoxy-2,4-dichlorobenzoic acid.
What is the SMILES notation for 3-tert-butylperoxy-2,4-dichlorobenzoic acid?
The canonical SMILES for 3-tert-butylperoxy-2,4-dichlorobenzoic acid is CC(C)(C)OOc1c(Cl)ccc(C(=O)O)c1Cl.
What is the InChIKey of 3-tert-butylperoxy-2,4-dichlorobenzoic acid?
The InChIKey is BTYVJDJBRSJFHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O4/c1-11(2,3)17-16-9-7(12)5-4-6(8(9)13)10(14)15/h4-5H,1-3H3,(H,14,15).
What are the key properties of 3-tert-butylperoxy-2,4-dichlorobenzoic acid?
3-tert-butylperoxy-2,4-dichlorobenzoic acid has a molecular weight of 279.12 g/mol, XLogP of 3.80, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butylperoxy-2,4-dichlorobenzoic acid is sourced from PubChem (CID 88604863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).