About platinum;(2S)-pyrrolidin-2-amine;sulfuric acid
platinum;(2S)-pyrrolidin-2-amine;sulfuric acid (PubChem CID 88607385) has the molecular formula C4H12N2O4PtS
and a molecular weight of 379.30 g/mol. Its IUPAC name is platinum;(2S)-pyrrolidin-2-amine;sulfuric acid.
Molecular Properties
| Compound Name | platinum;(2S)-pyrrolidin-2-amine;sulfuric acid |
| PubChem CID | 88607385 |
| Molecular Formula | C4H12N2O4PtS |
| Molecular Weight | 379.30 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | platinum;(2S)-pyrrolidin-2-amine;sulfuric acid |
| SMILES | N[C@@H]1CCCN1.O=S(=O)(O)O.[Pt] |
| InChI | InChI=1S/C4H10N2.H2O4S.Pt/c5-4-2-1-3-6-4;1-5(2,3)4;/h4,6H,1-3,5H2;(H2,1,2,3,4);/t4-;;/m0../s1 |
| InChIKey | DDCWOEGJIMIXRQ-FHNDMYTFSA-N |
| XLogP | -1.00 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.30 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze platinum;(2S)-pyrrolidin-2-amine;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;(2S)-pyrrolidin-2-amine;sulfuric acid?
The IUPAC name of platinum;(2S)-pyrrolidin-2-amine;sulfuric acid (CID 88607385) is platinum;(2S)-pyrrolidin-2-amine;sulfuric acid.
What is the SMILES notation for platinum;(2S)-pyrrolidin-2-amine;sulfuric acid?
The canonical SMILES for platinum;(2S)-pyrrolidin-2-amine;sulfuric acid is N[C@@H]1CCCN1.O=S(=O)(O)O.[Pt].
What is the InChIKey of platinum;(2S)-pyrrolidin-2-amine;sulfuric acid?
The InChIKey is DDCWOEGJIMIXRQ-FHNDMYTFSA-N. The full InChI is InChI=1S/C4H10N2.H2O4S.Pt/c5-4-2-1-3-6-4;1-5(2,3)4;/h4,6H,1-3,5H2;(H2,1,2,3,4);/t4-;;/m0../s1.
What are the key properties of platinum;(2S)-pyrrolidin-2-amine;sulfuric acid?
platinum;(2S)-pyrrolidin-2-amine;sulfuric acid has a molecular weight of 379.30 g/mol, XLogP of -1.00, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;(2S)-pyrrolidin-2-amine;sulfuric acid is sourced from PubChem (CID 88607385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).