About cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid
cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid (PubChem CID 158015012) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid.
Molecular Properties
| Compound Name | cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid |
| PubChem CID | 158015012 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid |
| SMILES | NC1CC1.O=C(O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C5H9NO2.C3H7N/c7-5(8)4-2-1-3-6-4;4-3-1-2-3/h4,6H,1-3H2,(H,7,8);3H,1-2,4H2/t4-;/m0./s1 |
| InChIKey | FFIQZEWFMBJDGN-WCCKRBBISA-N |
| XLogP | -0.07 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid?
The IUPAC name of cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid (CID 158015012) is cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid.
What is the SMILES notation for cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid?
The canonical SMILES for cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid is NC1CC1.O=C(O)[C@@H]1CCCN1.
What is the InChIKey of cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid?
The InChIKey is FFIQZEWFMBJDGN-WCCKRBBISA-N. The full InChI is InChI=1S/C5H9NO2.C3H7N/c7-5(8)4-2-1-3-6-4;4-3-1-2-3/h4,6H,1-3H2,(H,7,8);3H,1-2,4H2/t4-;/m0./s1.
What are the key properties of cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid?
cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid has a molecular weight of 172.23 g/mol, XLogP of -0.07, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanamine;(2S)-pyrrolidine-2-carboxylic acid is sourced from PubChem (CID 158015012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).