About 6-hydroxyiminohexyl acetate
6-hydroxyiminohexyl acetate (PubChem CID 88608680) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 6-hydroxyiminohexyl acetate.
Molecular Properties
| Compound Name | 6-hydroxyiminohexyl acetate |
| PubChem CID | 88608680 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 6-hydroxyiminohexyl acetate |
| SMILES | CC(=O)OCCCCCC=NO |
| InChI | InChI=1S/C8H15NO3/c1-8(10)12-7-5-3-2-4-6-9-11/h6,11H,2-5,7H2,1H3 |
| InChIKey | OJZDJRMIOPIMHY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-hydroxyiminohexyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-hydroxyiminohexyl acetate?
The IUPAC name of 6-hydroxyiminohexyl acetate (CID 88608680) is 6-hydroxyiminohexyl acetate.
What is the SMILES notation for 6-hydroxyiminohexyl acetate?
The canonical SMILES for 6-hydroxyiminohexyl acetate is CC(=O)OCCCCCC=NO.
What is the InChIKey of 6-hydroxyiminohexyl acetate?
The InChIKey is OJZDJRMIOPIMHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-8(10)12-7-5-3-2-4-6-9-11/h6,11H,2-5,7H2,1H3.
What are the key properties of 6-hydroxyiminohexyl acetate?
6-hydroxyiminohexyl acetate has a molecular weight of 173.21 g/mol, XLogP of 1.57, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-hydroxyiminohexyl acetate is sourced from PubChem (CID 88608680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).