C10H9ClO6 — CID 88609793
(3E)-2-chlorohepta-1,3,6-triene-2,3,4-tricarboxylic acid (PubChem CID 88609793) has the molecular formula C10H9ClO6 and a molecular weight of 260.63 g/mol. Its IUPAC name is (3E)-2-chlorohepta-1,3,6-triene-2,3,4-tricarboxylic acid.
| Compound Name | (3E)-2-chlorohepta-1,3,6-triene-2,3,4-tricarboxylic acid |
|---|---|
| PubChem CID | 88609793 |
| Molecular Formula | C10H9ClO6 |
| Molecular Weight | 260.63 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (3E)-2-chlorohepta-1,3,6-triene-2,3,4-tricarboxylic acid |
| SMILES | C=CC(C(=O)O)/C(C(=O)O)=C(\C(=C)Cl)C(=O)O |
| InChI | InChI=1S/C10H9ClO6/c1-3-5(8(12)13)7(10(16)17)6(4(2)11)9(14)15/h3,5H,1-2H2,(H,12,13)(H,14,15)(H,16,17)/b7-6- |
| InChIKey | JXVNGZAUTHIXOE-SREVYHEPSA-N |
| XLogP | 1.09 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.63 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|