About 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid
4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid (PubChem CID 174451761) has the molecular formula C8H8Cl2O2
and a molecular weight of 207.06 g/mol. Its IUPAC name is 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid |
| PubChem CID | 174451761 |
| Molecular Formula | C8H8Cl2O2 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid |
| SMILES | C=C(Cl)C(C(=C)Cl)=C(C)C(=O)O |
| InChI | InChI=1S/C8H8Cl2O2/c1-4(8(11)12)7(5(2)9)6(3)10/h2-3H2,1H3,(H,11,12) |
| InChIKey | LRKOZTZSYPUTMF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid?
The IUPAC name of 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid (CID 174451761) is 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid.
What is the SMILES notation for 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid?
The canonical SMILES for 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid is C=C(Cl)C(C(=C)Cl)=C(C)C(=O)O.
What is the InChIKey of 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid?
The InChIKey is LRKOZTZSYPUTMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8Cl2O2/c1-4(8(11)12)7(5(2)9)6(3)10/h2-3H2,1H3,(H,11,12).
What are the key properties of 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid?
4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid has a molecular weight of 207.06 g/mol, XLogP of 2.89, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-(1-chloroethenyl)-2-methylpenta-2,4-dienoic acid is sourced from PubChem (CID 174451761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).