C5H12N4O — CID 88609974
N-[1-(diaminomethylideneamino)ethyl]acetamide (PubChem CID 88609974) has the molecular formula C5H12N4O and a molecular weight of 144.18 g/mol. Its IUPAC name is N-[1-(diaminomethylideneamino)ethyl]acetamide.
| Compound Name | N-[1-(diaminomethylideneamino)ethyl]acetamide |
|---|---|
| PubChem CID | 88609974 |
| Molecular Formula | C5H12N4O |
| Molecular Weight | 144.18 g/mol |
| Exact Mass | 144.10 |
| IUPAC Name | N-[1-(diaminomethylideneamino)ethyl]acetamide |
| SMILES | CC(=O)NC(C)N=C(N)N |
| InChI | InChI=1S/C5H12N4O/c1-3(8-4(2)10)9-5(6)7/h3H,1-2H3,(H,8,10)(H4,6,7,9) |
| InChIKey | PVMSOYQQQVNJPQ-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.18 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|