C6H3F5N2O — CID 88610110
2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one (PubChem CID 88610110) has the molecular formula C6H3F5N2O and a molecular weight of 214.09 g/mol. Its IUPAC name is 2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 88610110 |
| Molecular Formula | C6H3F5N2O |
| Molecular Weight | 214.09 g/mol |
| Exact Mass | 214.02 |
| IUPAC Name | 2-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1ccnc(C(F)(F)C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C6H3F5N2O/c7-5(8,6(9,10)11)4-12-2-1-3(14)13-4/h1-2H,(H,12,13,14) |
| InChIKey | DDXACLJZTYZYNU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.09 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|