About 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium
3-ethylpentan-3-ylphosphane;tetrabutylphosphanium (PubChem CID 88610668) has the molecular formula C23H53P2+
and a molecular weight of 391.63 g/mol. Its IUPAC name is 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium.
Molecular Properties
| Compound Name | 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium |
| PubChem CID | 88610668 |
| Molecular Formula | C23H53P2+ |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.36 |
| IUPAC Name | 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium |
| SMILES | CCC(P)(CC)CC.CCCC[P+](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36P.C7H17P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-4-7(8,5-2)6-3/h5-16H2,1-4H3;4-6,8H2,1-3H3/q+1; |
| InChIKey | KYFRDSCICICBFP-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium?
The IUPAC name of 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium (CID 88610668) is 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium.
What is the SMILES notation for 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium?
The canonical SMILES for 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium is CCC(P)(CC)CC.CCCC[P+](CCCC)(CCCC)CCCC.
What is the InChIKey of 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium?
The InChIKey is KYFRDSCICICBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36P.C7H17P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-4-7(8,5-2)6-3/h5-16H2,1-4H3;4-6,8H2,1-3H3/q+1;.
What are the key properties of 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium?
3-ethylpentan-3-ylphosphane;tetrabutylphosphanium has a molecular weight of 391.63 g/mol, XLogP of 9.03, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylpentan-3-ylphosphane;tetrabutylphosphanium is sourced from PubChem (CID 88610668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).