C17H14O8S — CID 88611133
2-hydroxy-4-[2-(2-methoxycarbonylphenyl)-1-sulfonylethoxy]benzoic acid (PubChem CID 88611133) has the molecular formula C17H14O8S and a molecular weight of 378.36 g/mol. Its IUPAC name is 2-hydroxy-4-[2-(2-methoxycarbonylphenyl)-1-sulfonylethoxy]benzoic acid.
| Compound Name | 2-hydroxy-4-[2-(2-methoxycarbonylphenyl)-1-sulfonylethoxy]benzoic acid |
|---|---|
| PubChem CID | 88611133 |
| Molecular Formula | C17H14O8S |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 2-hydroxy-4-[2-(2-methoxycarbonylphenyl)-1-sulfonylethoxy]benzoic acid |
| SMILES | COC(=O)c1ccccc1CC(Oc1ccc(C(=O)O)c(O)c1)=S(=O)=O |
| InChI | InChI=1S/C17H14O8S/c1-24-17(21)12-5-3-2-4-10(12)8-15(26(22)23)25-11-6-7-13(16(19)20)14(18)9-11/h2-7,9,18H,8H2,1H3,(H,19,20) |
| InChIKey | QZLQZTRJSBPRNI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|