C13H12F3NO4S — CID 88611497
4-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]benzoic acid (PubChem CID 88611497) has the molecular formula C13H12F3NO4S and a molecular weight of 335.30 g/mol. Its IUPAC name is 4-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]benzoic acid.
| Compound Name | 4-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 88611497 |
| Molecular Formula | C13H12F3NO4S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | 4-[[2-(acetylsulfanylmethyl)-3,3,3-trifluoropropanoyl]amino]benzoic acid |
| SMILES | CC(=O)SCC(C(=O)Nc1ccc(C(=O)O)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H12F3NO4S/c1-7(18)22-6-10(13(14,15)16)11(19)17-9-4-2-8(3-5-9)12(20)21/h2-5,10H,6H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | KEQSVWAXYYCJKA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|