C16H16Cl2O4 — CID 88612128
5-(2-tert-butyl-3-methylphenyl)-2,3-dichloro-4,5-dioxopent-2-enoic acid (PubChem CID 88612128) has the molecular formula C16H16Cl2O4 and a molecular weight of 343.21 g/mol. Its IUPAC name is 5-(2-tert-butyl-3-methylphenyl)-2,3-dichloro-4,5-dioxopent-2-enoic acid.
| Compound Name | 5-(2-tert-butyl-3-methylphenyl)-2,3-dichloro-4,5-dioxopent-2-enoic acid |
|---|---|
| PubChem CID | 88612128 |
| Molecular Formula | C16H16Cl2O4 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 5-(2-tert-butyl-3-methylphenyl)-2,3-dichloro-4,5-dioxopent-2-enoic acid |
| SMILES | Cc1cccc(C(=O)C(=O)C(Cl)=C(Cl)C(=O)O)c1C(C)(C)C |
| InChI | InChI=1S/C16H16Cl2O4/c1-8-6-5-7-9(10(8)16(2,3)4)13(19)14(20)11(17)12(18)15(21)22/h5-7H,1-4H3,(H,21,22) |
| InChIKey | OYJNPOHAKHUZPS-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|