C26H43N3O5 — CID 88613353
N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-5-[formyl(phenylmethoxy)amino]-4-hydroxy-7-methyl-2-propan-2-yloctanamide (PubChem CID 88613353) has the molecular formula C26H43N3O5 and a molecular weight of 477.65 g/mol. Its IUPAC name is N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-5-[formyl(phenylmethoxy)amino]-4-hydroxy-7-methyl-2-propan-2-yloctanamide.
| Compound Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-5-[formyl(phenylmethoxy)amino]-4-hydroxy-7-methyl-2-propan-2-yloctanamide |
|---|---|
| PubChem CID | 88613353 |
| Molecular Formula | C26H43N3O5 |
| Molecular Weight | 477.65 g/mol |
| Exact Mass | 477.32 |
| IUPAC Name | N-[(2S)-1-amino-4-methyl-1-oxopentan-2-yl]-5-[formyl(phenylmethoxy)amino]-4-hydroxy-7-methyl-2-propan-2-yloctanamide |
| SMILES | CC(C)CC(C(O)CC(C(=O)N[C@@H](CC(C)C)C(N)=O)C(C)C)N(C=O)OCc1ccccc1 |
| InChI | InChI=1S/C26H43N3O5/c1-17(2)12-22(25(27)32)28-26(33)21(19(5)6)14-24(31)23(13-18(3)4)29(16-30)34-15-20-10-8-7-9-11-20/h7-11,16-19,21-24,31H,12-15H2,1-6H3,(H2,27,32)(H,28,33)/t21?,22-,23?,24?/m0/s1 |
| InChIKey | GRAFTWDZVWKVJB-REDCPHJYSA-N |
| XLogP | 3.03 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|