About N-chloro-N,2-bis(trifluoromethyl)aniline
N-chloro-N,2-bis(trifluoromethyl)aniline (PubChem CID 88613583) has the molecular formula C8H4ClF6N
and a molecular weight of 263.57 g/mol. Its IUPAC name is N-chloro-N,2-bis(trifluoromethyl)aniline.
Molecular Properties
| Compound Name | N-chloro-N,2-bis(trifluoromethyl)aniline |
| PubChem CID | 88613583 |
| Molecular Formula | C8H4ClF6N |
| Molecular Weight | 263.57 g/mol |
| Exact Mass | 262.99 |
| IUPAC Name | N-chloro-N,2-bis(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1ccccc1N(Cl)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF6N/c9-16(8(13,14)15)6-4-2-1-3-5(6)7(10,11)12/h1-4H |
| InChIKey | UKJIJMFPMQASDI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze N-chloro-N,2-bis(trifluoromethyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-chloro-N,2-bis(trifluoromethyl)aniline?
The IUPAC name of N-chloro-N,2-bis(trifluoromethyl)aniline (CID 88613583) is N-chloro-N,2-bis(trifluoromethyl)aniline.
What is the SMILES notation for N-chloro-N,2-bis(trifluoromethyl)aniline?
The canonical SMILES for N-chloro-N,2-bis(trifluoromethyl)aniline is FC(F)(F)c1ccccc1N(Cl)C(F)(F)F.
What is the InChIKey of N-chloro-N,2-bis(trifluoromethyl)aniline?
The InChIKey is UKJIJMFPMQASDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClF6N/c9-16(8(13,14)15)6-4-2-1-3-5(6)7(10,11)12/h1-4H.
What are the key properties of N-chloro-N,2-bis(trifluoromethyl)aniline?
N-chloro-N,2-bis(trifluoromethyl)aniline has a molecular weight of 263.57 g/mol, XLogP of 4.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-chloro-N,2-bis(trifluoromethyl)aniline is sourced from PubChem (CID 88613583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).