C15H32O3Si — CID 88616456
2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methylhexanoic acid (PubChem CID 88616456) has the molecular formula C15H32O3Si and a molecular weight of 288.50 g/mol. Its IUPAC name is 2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methylhexanoic acid.
| Compound Name | 2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methylhexanoic acid |
|---|---|
| PubChem CID | 88616456 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 2-[2,3-dimethylbutan-2-yl(dimethyl)silyl]oxy-4-methylhexanoic acid |
| SMILES | CCC(C)CC(O[Si](C)(C)C(C)(C)C(C)C)C(=O)O |
| InChI | InChI=1S/C15H32O3Si/c1-9-12(4)10-13(14(16)17)18-19(7,8)15(5,6)11(2)3/h11-13H,9-10H2,1-8H3,(H,16,17) |
| InChIKey | VXTANMQOVJLGAE-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|