C35H33O10PS2 — CID 88618208
methyl(phenyl)phosphane;bis(4-(5-methyl-2-sulfophenyl)benzoic acid) (PubChem CID 88618208) has the molecular formula C35H33O10PS2 and a molecular weight of 708.75 g/mol. Its IUPAC name is methyl(phenyl)phosphane;bis(4-(5-methyl-2-sulfophenyl)benzoic acid).
| Compound Name | methyl(phenyl)phosphane;bis(4-(5-methyl-2-sulfophenyl)benzoic acid) |
|---|---|
| PubChem CID | 88618208 |
| Molecular Formula | C35H33O10PS2 |
| Molecular Weight | 708.75 g/mol |
| Exact Mass | 708.13 |
| IUPAC Name | methyl(phenyl)phosphane;bis(4-(5-methyl-2-sulfophenyl)benzoic acid) |
| SMILES | CPc1ccccc1.Cc1ccc(S(=O)(=O)O)c(-c2ccc(C(=O)O)cc2)c1.Cc1ccc(S(=O)(=O)O)c(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/2C14H12O5S.C7H9P/c2*1-9-2-7-13(20(17,18)19)12(8-9)10-3-5-11(6-4-10)14(15)16;1-8-7-5-3-2-4-6-7/h2*2-8H,1H3,(H,15,16)(H,17,18,19);2-6,8H,1H3 |
| InChIKey | WDBYVKIUFRSYFW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 183.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.75 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|