About O-ethyl N-thiophosphorosocarbamothioate
O-ethyl N-thiophosphorosocarbamothioate (PubChem CID 88618781) has the molecular formula C3H6NOPS2
and a molecular weight of 167.19 g/mol. Its IUPAC name is O-ethyl N-thiophosphorosocarbamothioate.
Molecular Properties
| Compound Name | O-ethyl N-thiophosphorosocarbamothioate |
| PubChem CID | 88618781 |
| Molecular Formula | C3H6NOPS2 |
| Molecular Weight | 167.19 g/mol |
| Exact Mass | 166.96 |
| IUPAC Name | O-ethyl N-thiophosphorosocarbamothioate |
| SMILES | CCOC(=S)NP=S |
| InChI | InChI=1S/C3H6NOPS2/c1-2-5-3(7)4-6-8/h2H2,1H3,(H,4,7,8) |
| InChIKey | MIYMKOKMAXSNNX-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.19 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl N-thiophosphorosocarbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl N-thiophosphorosocarbamothioate?
The IUPAC name of O-ethyl N-thiophosphorosocarbamothioate (CID 88618781) is O-ethyl N-thiophosphorosocarbamothioate.
What is the SMILES notation for O-ethyl N-thiophosphorosocarbamothioate?
The canonical SMILES for O-ethyl N-thiophosphorosocarbamothioate is CCOC(=S)NP=S.
What is the InChIKey of O-ethyl N-thiophosphorosocarbamothioate?
The InChIKey is MIYMKOKMAXSNNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6NOPS2/c1-2-5-3(7)4-6-8/h2H2,1H3,(H,4,7,8).
What are the key properties of O-ethyl N-thiophosphorosocarbamothioate?
O-ethyl N-thiophosphorosocarbamothioate has a molecular weight of 167.19 g/mol, XLogP of 1.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl N-thiophosphorosocarbamothioate is sourced from PubChem (CID 88618781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).