C19H17N9O5S2 — CID 88619108
(6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-b]pyridazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88619108) has the molecular formula C19H17N9O5S2 and a molecular weight of 515.54 g/mol. Its IUPAC name is (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-b]pyridazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-b]pyridazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88619108 |
| Molecular Formula | C19H17N9O5S2 |
| Molecular Weight | 515.54 g/mol |
| Exact Mass | 515.08 |
| IUPAC Name | (6R)-7-[[(2Z)-2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-([1,2,4]triazolo[1,5-b]pyridazin-1-ium-1-ylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cnn4ncccc43)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C19H17N9O5S2/c1-33-25-12(10-7-35-19(20)23-10)15(29)24-13-16(30)27-14(18(31)32)9(6-34-17(13)27)5-26-8-22-28-11(26)3-2-4-21-28/h2-4,7-8,13,17H,5-6H2,1H3,(H3-,20,23,24,29,31,32)/b25-12-/t13?,17-/m1/s1 |
| InChIKey | PIAVMWQXSGDMAY-MYJOAHPBSA-N |
| XLogP | -2.49 |
| TPSA | 184.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.54 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|