C23H21N7O5S2 — CID 88733481
(6S)-3-[(3-aminoquinolin-1-ium-1-yl)methyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88733481) has the molecular formula C23H21N7O5S2 and a molecular weight of 539.60 g/mol. Its IUPAC name is (6S)-3-[(3-aminoquinolin-1-ium-1-yl)methyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | (6S)-3-[(3-aminoquinolin-1-ium-1-yl)methyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88733481 |
| Molecular Formula | C23H21N7O5S2 |
| Molecular Weight | 539.60 g/mol |
| Exact Mass | 539.10 |
| IUPAC Name | (6S)-3-[(3-aminoquinolin-1-ium-1-yl)methyl]-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)NC1C(=O)N2C(C(=O)[O-])=C(C[n+]3cc(N)cc4ccccc43)CS[C@@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C23H21N7O5S2/c1-35-28-16(14-10-37-23(25)26-14)19(31)27-17-20(32)30-18(22(33)34)12(9-36-21(17)30)7-29-8-13(24)6-11-4-2-3-5-15(11)29/h2-6,8,10,17,21H,7,9,24H2,1H3,(H3-,25,26,27,31,33,34)/t17?,21-/m0/s1 |
| InChIKey | NICPFECTAXDYDX-LFABVHOISA-N |
| XLogP | -0.80 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.60 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|