C18H19N3O7S — CID 88619659
(2S,5R,6R)-6-[(2-carboxy-2-phenylacetyl)amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88619659) has the molecular formula C18H19N3O7S and a molecular weight of 421.43 g/mol. Its IUPAC name is (2S,5R,6R)-6-[(2-carboxy-2-phenylacetyl)amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-[(2-carboxy-2-phenylacetyl)amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88619659 |
| Molecular Formula | C18H19N3O7S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | (2S,5R,6R)-6-[(2-carboxy-2-phenylacetyl)amino]-6-formamido-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)[C@@]2(NC=O)NC(=O)C(C(=O)O)c2ccccc2)[C@H]1C(=O)O |
| InChI | InChI=1S/C18H19N3O7S/c1-17(2)11(14(26)27)21-15(28)18(19-8-22,16(21)29-17)20-12(23)10(13(24)25)9-6-4-3-5-7-9/h3-8,10-11,16H,1-2H3,(H,19,22)(H,20,23)(H,24,25)(H,26,27)/t10?,11-,16+,18+/m0/s1 |
| InChIKey | WQIQQWKRFQUBPE-RITBBALJSA-N |
| XLogP | -0.44 |
| TPSA | 153.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|