C17H19N3O8S2 — CID 88619678
(2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-6-[(2-phenyl-2-sulfoacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 88619678) has the molecular formula C17H19N3O8S2 and a molecular weight of 457.49 g/mol. Its IUPAC name is (2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-6-[(2-phenyl-2-sulfoacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-6-[(2-phenyl-2-sulfoacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 88619678 |
| Molecular Formula | C17H19N3O8S2 |
| Molecular Weight | 457.49 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (2S,5R,6R)-6-formamido-3,3-dimethyl-7-oxo-6-[(2-phenyl-2-sulfoacetyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C)S[C@H]2N(C(=O)[C@@]2(NC=O)NC(=O)C(c2ccccc2)S(=O)(=O)O)[C@H]1C(=O)O |
| InChI | InChI=1S/C17H19N3O8S2/c1-16(2)11(13(23)24)20-14(25)17(18-8-21,15(20)29-16)19-12(22)10(30(26,27)28)9-6-4-3-5-7-9/h3-8,10-11,15H,1-2H3,(H,18,21)(H,19,22)(H,23,24)(H,26,27,28)/t10?,11-,15+,17+/m0/s1 |
| InChIKey | DNBDQUMRDDTJAO-BQXYYCQUSA-N |
| XLogP | -0.68 |
| TPSA | 170.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.49 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|