About zinc;hydrogen sulfate;cyanide
zinc;hydrogen sulfate;cyanide (PubChem CID 88619780) has the molecular formula CHNO4SZn
and a molecular weight of 188.48 g/mol. Its IUPAC name is zinc;hydrogen sulfate;cyanide.
Molecular Properties
| Compound Name | zinc;hydrogen sulfate;cyanide |
| PubChem CID | 88619780 |
| Molecular Formula | CHNO4SZn |
| Molecular Weight | 188.48 g/mol |
| Exact Mass | 186.89 |
| IUPAC Name | zinc;hydrogen sulfate;cyanide |
| SMILES | O=S(=O)([O-])O.[C-]#N.[Zn+2] |
| InChI | InChI=1S/CN.H2O4S.Zn/c1-2;1-5(2,3)4;/h;(H2,1,2,3,4);/q-1;;+2/p-1 |
| InChIKey | HVQJFNMDYCCIIW-UHFFFAOYSA-M |
| XLogP | -0.90 |
| TPSA | 101.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.48 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze zinc;hydrogen sulfate;cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;hydrogen sulfate;cyanide?
The IUPAC name of zinc;hydrogen sulfate;cyanide (CID 88619780) is zinc;hydrogen sulfate;cyanide.
What is the SMILES notation for zinc;hydrogen sulfate;cyanide?
The canonical SMILES for zinc;hydrogen sulfate;cyanide is O=S(=O)([O-])O.[C-]#N.[Zn+2].
What is the InChIKey of zinc;hydrogen sulfate;cyanide?
The InChIKey is HVQJFNMDYCCIIW-UHFFFAOYSA-M. The full InChI is InChI=1S/CN.H2O4S.Zn/c1-2;1-5(2,3)4;/h;(H2,1,2,3,4);/q-1;;+2/p-1.
What are the key properties of zinc;hydrogen sulfate;cyanide?
zinc;hydrogen sulfate;cyanide has a molecular weight of 188.48 g/mol, XLogP of -0.90, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;hydrogen sulfate;cyanide is sourced from PubChem (CID 88619780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).