C8H16N4O2 — CID 88620184
(Z)-1-N,1-N',4-N,4-N'-tetramethylbut-2-enedihydrazide (PubChem CID 88620184) has the molecular formula C8H16N4O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is (Z)-1-N,1-N',4-N,4-N'-tetramethylbut-2-enedihydrazide.
| Compound Name | (Z)-1-N,1-N',4-N,4-N'-tetramethylbut-2-enedihydrazide |
|---|---|
| PubChem CID | 88620184 |
| Molecular Formula | C8H16N4O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (Z)-1-N,1-N',4-N,4-N'-tetramethylbut-2-enedihydrazide |
| SMILES | CNN(C)C(=O)/C=C\C(=O)N(C)NC |
| InChI | InChI=1S/C8H16N4O2/c1-9-11(3)7(13)5-6-8(14)12(4)10-2/h5-6,9-10H,1-4H3/b6-5- |
| InChIKey | PQDGINSJTIMNCE-WAYWQWQTSA-N |
| XLogP | -1.27 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|