About (E)-N,N'-dimethylbut-2-enehydrazide
(E)-N,N'-dimethylbut-2-enehydrazide (PubChem CID 88655369) has the molecular formula C6H12N2O
and a molecular weight of 128.17 g/mol. Its IUPAC name is (E)-N,N'-dimethylbut-2-enehydrazide.
Molecular Properties
| Compound Name | (E)-N,N'-dimethylbut-2-enehydrazide |
| PubChem CID | 88655369 |
| Molecular Formula | C6H12N2O |
| Molecular Weight | 128.17 g/mol |
| Exact Mass | 128.09 |
| IUPAC Name | (E)-N,N'-dimethylbut-2-enehydrazide |
| SMILES | C/C=C/C(=O)N(C)NC |
| InChI | InChI=1S/C6H12N2O/c1-4-5-6(9)8(3)7-2/h4-5,7H,1-3H3/b5-4+ |
| InChIKey | WEJRLPMBWFEXFR-SNAWJCMRSA-N |
| XLogP | 0.16 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.17 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N,N'-dimethylbut-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N'-dimethylbut-2-enehydrazide?
The IUPAC name of (E)-N,N'-dimethylbut-2-enehydrazide (CID 88655369) is (E)-N,N'-dimethylbut-2-enehydrazide.
What is the SMILES notation for (E)-N,N'-dimethylbut-2-enehydrazide?
The canonical SMILES for (E)-N,N'-dimethylbut-2-enehydrazide is C/C=C/C(=O)N(C)NC.
What is the InChIKey of (E)-N,N'-dimethylbut-2-enehydrazide?
The InChIKey is WEJRLPMBWFEXFR-SNAWJCMRSA-N. The full InChI is InChI=1S/C6H12N2O/c1-4-5-6(9)8(3)7-2/h4-5,7H,1-3H3/b5-4+.
What are the key properties of (E)-N,N'-dimethylbut-2-enehydrazide?
(E)-N,N'-dimethylbut-2-enehydrazide has a molecular weight of 128.17 g/mol, XLogP of 0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N'-dimethylbut-2-enehydrazide is sourced from PubChem (CID 88655369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).