C10H14O4S3 — CID 88620871
Ethyl 2-[3-(1,3-dithiol-2-ylidene)propylsulfonyl]acetate (PubChem CID 88620871) has the molecular formula C10H14O4S3 and a molecular weight of 294.40 g/mol. Its IUPAC name is ethyl 2-[3-(1,3-dithiol-2-ylidene)propylsulfonyl]acetate.
| Compound Name | Ethyl 2-[3-(1,3-dithiol-2-ylidene)propylsulfonyl]acetate |
|---|---|
| PubChem CID | 88620871 |
| Molecular Formula | C10H14O4S3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | ethyl 2-[3-(1,3-dithiol-2-ylidene)propylsulfonyl]acetate |
| SMILES | CCOC(=O)CS(=O)(=O)CCC=C1SC=CS1 |
| InChI | InChI=1S/C10H14O4S3/c1-2-14-9(11)8-17(12,13)7-3-4-10-15-5-6-16-10/h4-6H,2-3,7-8H2,1H3 |
| InChIKey | OYQLAFPOIWIHDD-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 119.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | 407 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |