C10H14O4S3 — CID 14230915
ethyl 2-(1,3-dithiol-2-ylidene)-2-propylsulfonylacetate (PubChem CID 14230915) has the molecular formula C10H14O4S3 and a molecular weight of 294.42 g/mol. Its IUPAC name is ethyl 2-(1,3-dithiol-2-ylidene)-2-propylsulfonylacetate.
| Compound Name | ethyl 2-(1,3-dithiol-2-ylidene)-2-propylsulfonylacetate |
|---|---|
| PubChem CID | 14230915 |
| Molecular Formula | C10H14O4S3 |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.01 |
| IUPAC Name | ethyl 2-(1,3-dithiol-2-ylidene)-2-propylsulfonylacetate |
| SMILES | CCCS(=O)(=O)C(C(=O)OCC)=C1SC=CS1 |
| InChI | InChI=1S/C10H14O4S3/c1-3-7-17(12,13)8(9(11)14-4-2)10-15-5-6-16-10/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | RDSOVNRBGCPDOJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|