C12H27NO4S — CID 88621077
2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid (PubChem CID 88621077) has the molecular formula C12H27NO4S and a molecular weight of 281.42 g/mol. Its IUPAC name is 2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid.
| Compound Name | 2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid |
|---|---|
| PubChem CID | 88621077 |
| Molecular Formula | C12H27NO4S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 2-(diethylaminomethyl)cyclohexan-1-ol;methanesulfonic acid |
| SMILES | CCN(CC)CC1CCCCC1O.CS(=O)(=O)O |
| InChI | InChI=1S/C11H23NO.CH4O3S/c1-3-12(4-2)9-10-7-5-6-8-11(10)13;1-5(2,3)4/h10-11,13H,3-9H2,1-2H3;1H3,(H,2,3,4) |
| InChIKey | XOCOIZHRSWZUAI-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|