C27H44N2O5S2 — CID 88625405
4-methylbenzenesulfonic acid;N-[4-[4-(nonan-3-ylamino)butyl]phenyl]methanesulfonamide (PubChem CID 88625405) has the molecular formula C27H44N2O5S2 and a molecular weight of 540.79 g/mol. Its IUPAC name is 4-methylbenzenesulfonic acid;N-[4-[4-(nonan-3-ylamino)butyl]phenyl]methanesulfonamide.
| Compound Name | 4-methylbenzenesulfonic acid;N-[4-[4-(nonan-3-ylamino)butyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 88625405 |
| Molecular Formula | C27H44N2O5S2 |
| Molecular Weight | 540.79 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | 4-methylbenzenesulfonic acid;N-[4-[4-(nonan-3-ylamino)butyl]phenyl]methanesulfonamide |
| SMILES | CCCCCCC(CC)NCCCCc1ccc(NS(C)(=O)=O)cc1.Cc1ccc(S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C20H36N2O2S.C7H8O3S/c1-4-6-7-8-12-19(5-2)21-17-10-9-11-18-13-15-20(16-14-18)22-25(3,23)24;1-6-2-4-7(5-3-6)11(8,9)10/h13-16,19,21-22H,4-12,17H2,1-3H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | WLDIMDCHFJFMJI-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.79 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|