C24H36N2O3S — CID 19873383
N-[4-[1-hydroxy-2-(nonan-3-ylamino)ethyl]phenyl]-4-methylbenzenesulfonamide (PubChem CID 19873383) has the molecular formula C24H36N2O3S and a molecular weight of 432.63 g/mol. Its IUPAC name is N-[4-[1-hydroxy-2-(nonan-3-ylamino)ethyl]phenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[4-[1-hydroxy-2-(nonan-3-ylamino)ethyl]phenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 19873383 |
| Molecular Formula | C24H36N2O3S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 432.24 |
| IUPAC Name | N-[4-[1-hydroxy-2-(nonan-3-ylamino)ethyl]phenyl]-4-methylbenzenesulfonamide |
| SMILES | CCCCCCC(CC)NCC(O)c1ccc(NS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H36N2O3S/c1-4-6-7-8-9-21(5-2)25-18-24(27)20-12-14-22(15-13-20)26-30(28,29)23-16-10-19(3)11-17-23/h10-17,21,24-27H,4-9,18H2,1-3H3 |
| InChIKey | GNZIKZFSVVKQQO-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|