C32H16F6N4O9 — CID 88627806
methyl 2-cyano-3-[2-cyano-3-methoxycarbonyl-4-nitro-5-[4-(trifluoromethyl)phenyl]phenoxy]-6-nitro-5-[4-(trifluoromethyl)phenyl]benzoate (PubChem CID 88627806) has the molecular formula C32H16F6N4O9 and a molecular weight of 714.49 g/mol. Its IUPAC name is methyl 2-cyano-3-[2-cyano-3-methoxycarbonyl-4-nitro-5-[4-(trifluoromethyl)phenyl]phenoxy]-6-nitro-5-[4-(trifluoromethyl)phenyl]benzoate.
| Compound Name | methyl 2-cyano-3-[2-cyano-3-methoxycarbonyl-4-nitro-5-[4-(trifluoromethyl)phenyl]phenoxy]-6-nitro-5-[4-(trifluoromethyl)phenyl]benzoate |
|---|---|
| PubChem CID | 88627806 |
| Molecular Formula | C32H16F6N4O9 |
| Molecular Weight | 714.49 g/mol |
| Exact Mass | 714.08 |
| IUPAC Name | methyl 2-cyano-3-[2-cyano-3-methoxycarbonyl-4-nitro-5-[4-(trifluoromethyl)phenyl]phenoxy]-6-nitro-5-[4-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1c(C#N)c(Oc2cc(-c3ccc(C(F)(F)F)cc3)c([N+](=O)[O-])c(C(=O)OC)c2C#N)cc(-c2ccc(C(F)(F)F)cc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C32H16F6N4O9/c1-49-29(43)25-21(13-39)23(11-19(27(25)41(45)46)15-3-7-17(8-4-15)31(33,34)35)51-24-12-20(16-5-9-18(10-6-16)32(36,37)38)28(42(47)48)26(22(24)14-40)30(44)50-2/h3-12H,1-2H3 |
| InChIKey | JLUZZFNWLUPKQO-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 195.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.49 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|