C6H10ClN2+ — CID 88629597
4-chloro-3,6-dimethyl-1,2-dihydropyrimidin-3-ium (PubChem CID 88629597) has the molecular formula C6H10ClN2+ and a molecular weight of 145.61 g/mol. Its IUPAC name is 4-chloro-3,6-dimethyl-1,2-dihydropyrimidin-3-ium.
| Compound Name | 4-chloro-3,6-dimethyl-1,2-dihydropyrimidin-3-ium |
|---|---|
| PubChem CID | 88629597 |
| Molecular Formula | C6H10ClN2+ |
| Molecular Weight | 145.61 g/mol |
| Exact Mass | 145.05 |
| IUPAC Name | 4-chloro-3,6-dimethyl-1,2-dihydropyrimidin-3-ium |
| SMILES | CC1=CC(Cl)=[N+](C)CN1 |
| InChI | InChI=1S/C6H9ClN2/c1-5-3-6(7)9(2)4-8-5/h3H,4H2,1-2H3/p+1 |
| InChIKey | HEOPMTDOAPVFRJ-UHFFFAOYSA-O |
| XLogP | 0.73 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.61 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|