C7H9ClN2 — CID 123459081
4-chloro-1,6-dimethyl-2-methylidenepyrimidine (PubChem CID 123459081) has the molecular formula C7H9ClN2 and a molecular weight of 156.62 g/mol. Its IUPAC name is 4-chloro-1,6-dimethyl-2-methylidenepyrimidine.
| Compound Name | 4-chloro-1,6-dimethyl-2-methylidenepyrimidine |
|---|---|
| PubChem CID | 123459081 |
| Molecular Formula | C7H9ClN2 |
| Molecular Weight | 156.62 g/mol |
| Exact Mass | 156.05 |
| IUPAC Name | 4-chloro-1,6-dimethyl-2-methylidenepyrimidine |
| SMILES | C=C1N=C(Cl)C=C(C)N1C |
| InChI | InChI=1S/C7H9ClN2/c1-5-4-7(8)9-6(2)10(5)3/h4H,2H2,1,3H3 |
| InChIKey | MLLZABYOJMURAL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.62 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |