C6H9ClN2 — CID 154025256
2-chloro-1,6-dimethyl-2H-pyrimidine (PubChem CID 154025256) has the molecular formula C6H9ClN2 and a molecular weight of 144.60 g/mol. Its IUPAC name is 2-chloro-1,6-dimethyl-2H-pyrimidine.
| Compound Name | 2-chloro-1,6-dimethyl-2H-pyrimidine |
|---|---|
| PubChem CID | 154025256 |
| Molecular Formula | C6H9ClN2 |
| Molecular Weight | 144.60 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | 2-chloro-1,6-dimethyl-2H-pyrimidine |
| SMILES | CC1=CC=NC(Cl)N1C |
| InChI | InChI=1S/C6H9ClN2/c1-5-3-4-8-6(7)9(5)2/h3-4,6H,1-2H3 |
| InChIKey | JVSPAUIBXJOJGK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.60 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|