C31H28IN3O2Te — CID 88629729
2-[3-(3H-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium;1-methyl-2H-benzo[e][1,3]benzotellurazole;iodide (PubChem CID 88629729) has the molecular formula C31H28IN3O2Te and a molecular weight of 729.09 g/mol. Its IUPAC name is 2-[3-(3H-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium;1-methyl-2H-benzo[e][1,3]benzotellurazole;iodide.
| Compound Name | 2-[3-(3H-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium;1-methyl-2H-benzo[e][1,3]benzotellurazole;iodide |
|---|---|
| PubChem CID | 88629729 |
| Molecular Formula | C31H28IN3O2Te |
| Molecular Weight | 729.09 g/mol |
| Exact Mass | 731.03 |
| IUPAC Name | 2-[3-(3H-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethyl-1,3-benzoxazol-3-ium;1-methyl-2H-benzo[e][1,3]benzotellurazole;iodide |
| SMILES | CC[n+]1c(C=CC=C2Nc3ccccc3O2)oc2ccccc21.CN1C[Te]c2ccc3ccccc3c21.[I-] |
| InChI | InChI=1S/C19H16N2O2.C12H11NTe.HI/c1-2-21-15-9-4-6-11-17(15)23-19(21)13-7-12-18-20-14-8-3-5-10-16(14)22-18;1-13-8-14-11-7-6-9-4-2-3-5-10(9)12(11)13;/h3-13H,2H2,1H3;2-7H,8H2,1H3;1H |
| InChIKey | IUASBZNGHSRJKK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|