C23H28BrF3O3 — CID 88631572
(8R,9S,10R,13S,14S,17S)-17-(2-bromoacetyl)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one (PubChem CID 88631572) has the molecular formula C23H28BrF3O3 and a molecular weight of 489.37 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S,17S)-17-(2-bromoacetyl)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one.
| Compound Name | (8R,9S,10R,13S,14S,17S)-17-(2-bromoacetyl)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
|---|---|
| PubChem CID | 88631572 |
| Molecular Formula | C23H28BrF3O3 |
| Molecular Weight | 489.37 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (8R,9S,10R,13S,14S,17S)-17-(2-bromoacetyl)-10,13-dimethyl-17-(2,2,2-trifluoroacetyl)-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]1[C@@H]2CC[C@@]2(C)[C@H]1CC[C@@]2(C(=O)CBr)C(=O)C(F)(F)F |
| InChI | InChI=1S/C23H28BrF3O3/c1-20-8-5-14(28)11-13(20)3-4-15-16(20)6-9-21(2)17(15)7-10-22(21,18(29)12-24)19(30)23(25,26)27/h11,15-17H,3-10,12H2,1-2H3/t15-,16+,17+,20+,21+,22-/m1/s1 |
| InChIKey | NWSIPSKBPRONLV-XMMAIYDSSA-N |
| XLogP | 5.60 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.37 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|